C43H40O3 — CID 100983524
6,8-ditert-butyl-1,2,3a,9a-tetraphenylcyclopenta[b][1,4]benzodioxin-3-one (PubChem CID 100983524) has the molecular formula C43H40O3 and a molecular weight of 604.79 g/mol. Its IUPAC name is 6,8-ditert-butyl-1,2,3a,9a-tetraphenylcyclopenta[b][1,4]benzodioxin-3-one.
| Compound Name | 6,8-ditert-butyl-1,2,3a,9a-tetraphenylcyclopenta[b][1,4]benzodioxin-3-one |
|---|---|
| PubChem CID | 100983524 |
| Molecular Formula | C43H40O3 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | 6,8-ditert-butyl-1,2,3a,9a-tetraphenylcyclopenta[b][1,4]benzodioxin-3-one |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OC1(c3ccccc3)C(c3ccccc3)=C(c3ccccc3)C(=O)C1(c1ccccc1)O2 |
| InChI | InChI=1S/C43H40O3/c1-40(2,3)33-27-34(41(4,5)6)38-35(28-33)45-43(32-25-17-10-18-26-32)39(44)36(29-19-11-7-12-20-29)37(30-21-13-8-14-22-30)42(43,46-38)31-23-15-9-16-24-31/h7-28H,1-6H3 |
| InChIKey | ULXRPUCAJWLMHR-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|