C12H17F8O3P — CID 100985719
(E)-1-di(propan-2-yloxy)phosphoryl-1,1,4,4,4-pentafluoro-3-methyl-2-(trifluoromethyl)but-2-ene (PubChem CID 100985719) has the molecular formula C12H17F8O3P and a molecular weight of 392.22 g/mol. Its IUPAC name is (E)-1-di(propan-2-yloxy)phosphoryl-1,1,4,4,4-pentafluoro-3-methyl-2-(trifluoromethyl)but-2-ene.
| Compound Name | (E)-1-di(propan-2-yloxy)phosphoryl-1,1,4,4,4-pentafluoro-3-methyl-2-(trifluoromethyl)but-2-ene |
|---|---|
| PubChem CID | 100985719 |
| Molecular Formula | C12H17F8O3P |
| Molecular Weight | 392.22 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (E)-1-di(propan-2-yloxy)phosphoryl-1,1,4,4,4-pentafluoro-3-methyl-2-(trifluoromethyl)but-2-ene |
| SMILES | C/C(=C(/C(F)(F)F)C(F)(F)P(=O)(OC(C)C)OC(C)C)C(F)(F)F |
| InChI | InChI=1S/C12H17F8O3P/c1-6(2)22-24(21,23-7(3)4)12(19,20)9(11(16,17)18)8(5)10(13,14)15/h6-7H,1-5H3/b9-8+ |
| InChIKey | MREFOYJDFAZMLR-CMDGGOBGSA-N |
| XLogP | 6.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.22 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|