C24H27NO2S — CID 100992129
N-benzyl-1,5,5-trimethyl-6,15-dioxatetracyclo[9.3.1.04,13.07,12]pentadeca-7,9,11-triene-8-carbothioamide (PubChem CID 100992129) has the molecular formula C24H27NO2S and a molecular weight of 393.55 g/mol. Its IUPAC name is N-benzyl-1,5,5-trimethyl-6,15-dioxatetracyclo[9.3.1.04,13.07,12]pentadeca-7,9,11-triene-8-carbothioamide.
| Compound Name | N-benzyl-1,5,5-trimethyl-6,15-dioxatetracyclo[9.3.1.04,13.07,12]pentadeca-7,9,11-triene-8-carbothioamide |
|---|---|
| PubChem CID | 100992129 |
| Molecular Formula | C24H27NO2S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-benzyl-1,5,5-trimethyl-6,15-dioxatetracyclo[9.3.1.04,13.07,12]pentadeca-7,9,11-triene-8-carbothioamide |
| SMILES | CC12CCC3C(C1)c1c(ccc(C(=S)NCc4ccccc4)c1OC3(C)C)O2 |
| InChI | InChI=1S/C24H27NO2S/c1-23(2)18-11-12-24(3)13-17(18)20-19(26-24)10-9-16(21(20)27-23)22(28)25-14-15-7-5-4-6-8-15/h4-10,17-18H,11-14H2,1-3H3,(H,25,28) |
| InChIKey | BGYDRYZWPZSWFH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|