C14H17+ — CID 100999649
3-[(1Z)-octa-1,3-dienyl]cyclohexa-1,2,4-triene (PubChem CID 100999649) has the molecular formula C14H17+ and a molecular weight of 185.29 g/mol. Its IUPAC name is 3-[(1Z)-octa-1,3-dienyl]cyclohexa-1,2,4-triene.
| Compound Name | 3-[(1Z)-octa-1,3-dienyl]cyclohexa-1,2,4-triene |
|---|---|
| PubChem CID | 100999649 |
| Molecular Formula | C14H17+ |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | 3-[(1Z)-octa-1,3-dienyl]cyclohexa-1,2,4-triene |
| SMILES | CCCC/[C+]=C/C=C\C1=C=CCC=C1 |
| InChI | InChI=1S/C14H17/c1-2-3-4-5-6-8-11-14-12-9-7-10-13-14/h6,8-12H,2-4,7H2,1H3/q+1/b11-8- |
| InChIKey | QPCOOOSEDGYVHM-FLIBITNWSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|