C36H36FNO7 — CID 10100316
ethyl 7-[1-benzhydryloxycarbonyl-3-(methoxymethoxy)cyclopentyl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate (PubChem CID 10100316) has the molecular formula C36H36FNO7 and a molecular weight of 613.68 g/mol. Its IUPAC name is ethyl 7-[1-benzhydryloxycarbonyl-3-(methoxymethoxy)cyclopentyl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 7-[1-benzhydryloxycarbonyl-3-(methoxymethoxy)cyclopentyl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 10100316 |
| Molecular Formula | C36H36FNO7 |
| Molecular Weight | 613.68 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | ethyl 7-[1-benzhydryloxycarbonyl-3-(methoxymethoxy)cyclopentyl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2)c2cc(C3(C(=O)OC(c4ccccc4)c4ccccc4)CCC(OCOC)C3)c(F)cc2c1=O |
| InChI | InChI=1S/C36H36FNO7/c1-3-43-34(40)28-21-38(25-14-15-25)31-19-29(30(37)18-27(31)32(28)39)36(17-16-26(20-36)44-22-42-2)35(41)45-33(23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-13,18-19,21,25-26,33H,3,14-17,20,22H2,1-2H3 |
| InChIKey | RICHLTGKWPHTDW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.68 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|