C15H28Si — CID 101008358
tert-butyl-dimethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 101008358) has the molecular formula C15H28Si and a molecular weight of 236.47 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | tert-butyl-dimethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 101008358 |
| Molecular Formula | C15H28Si |
| Molecular Weight | 236.47 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | tert-butyl-dimethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)C([Si](C)(C)C(C)(C)C)=C1C |
| InChI | InChI=1S/C15H28Si/c1-10-11(2)13(4)14(12(10)3)16(8,9)15(5,6)7/h12H,1-9H3 |
| InChIKey | UXSCBDPGGKXMSC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|