C11H22N+ — CID 101019525
(1R)-2,2,7,7-tetramethyl-2-azoniabicyclo[4.1.1]octane (PubChem CID 101019525) has the molecular formula C11H22N+ and a molecular weight of 168.30 g/mol. Its IUPAC name is (1R)-2,2,7,7-tetramethyl-2-azoniabicyclo[4.1.1]octane.
| Compound Name | (1R)-2,2,7,7-tetramethyl-2-azoniabicyclo[4.1.1]octane |
|---|---|
| PubChem CID | 101019525 |
| Molecular Formula | C11H22N+ |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.17 |
| IUPAC Name | (1R)-2,2,7,7-tetramethyl-2-azoniabicyclo[4.1.1]octane |
| SMILES | CC1(C)C2CCC[N+](C)(C)[C@@H]1C2 |
| InChI | InChI=1S/C11H22N/c1-11(2)9-6-5-7-12(3,4)10(11)8-9/h9-10H,5-8H2,1-4H3/q+1/t9?,10-/m1/s1 |
| InChIKey | GJLMOWPMNZHNON-QVDQXJPCSA-N |
| XLogP | 2.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|