About N-diphenylphosphanyl-2,2-dimethoxyethanamine
N-diphenylphosphanyl-2,2-dimethoxyethanamine (PubChem CID 101031572) has the molecular formula C16H20NO2P
and a molecular weight of 289.32 g/mol. Its IUPAC name is N-diphenylphosphanyl-2,2-dimethoxyethanamine.
Molecular Properties
| Compound Name | N-diphenylphosphanyl-2,2-dimethoxyethanamine |
| PubChem CID | 101031572 |
| Molecular Formula | C16H20NO2P |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-diphenylphosphanyl-2,2-dimethoxyethanamine |
| SMILES | COC(CNP(c1ccccc1)c1ccccc1)OC |
| InChI | InChI=1S/C16H20NO2P/c1-18-16(19-2)13-17-20(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16-17H,13H2,1-2H3 |
| InChIKey | BKMPVHXTXQAYJQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-diphenylphosphanyl-2,2-dimethoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-diphenylphosphanyl-2,2-dimethoxyethanamine?
The IUPAC name of N-diphenylphosphanyl-2,2-dimethoxyethanamine (CID 101031572) is N-diphenylphosphanyl-2,2-dimethoxyethanamine.
What is the SMILES notation for N-diphenylphosphanyl-2,2-dimethoxyethanamine?
The canonical SMILES for N-diphenylphosphanyl-2,2-dimethoxyethanamine is COC(CNP(c1ccccc1)c1ccccc1)OC.
What is the InChIKey of N-diphenylphosphanyl-2,2-dimethoxyethanamine?
The InChIKey is BKMPVHXTXQAYJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20NO2P/c1-18-16(19-2)13-17-20(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16-17H,13H2,1-2H3.
What are the key properties of N-diphenylphosphanyl-2,2-dimethoxyethanamine?
N-diphenylphosphanyl-2,2-dimethoxyethanamine has a molecular weight of 289.32 g/mol, XLogP of 2.24, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-diphenylphosphanyl-2,2-dimethoxyethanamine is sourced from PubChem (CID 101031572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).