C16H20NO2P — CID 101031572
N-diphenylphosphanyl-2,2-dimethoxyethanamine (PubChem CID 101031572) has the molecular formula C16H20NO2P and a molecular weight of 289.32 g/mol. Its IUPAC name is N-diphenylphosphanyl-2,2-dimethoxyethanamine.
| Compound Name | N-diphenylphosphanyl-2,2-dimethoxyethanamine |
|---|---|
| PubChem CID | 101031572 |
| Molecular Formula | C16H20NO2P |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-diphenylphosphanyl-2,2-dimethoxyethanamine |
| SMILES | COC(CNP(c1ccccc1)c1ccccc1)OC |
| InChI | InChI=1S/C16H20NO2P/c1-18-16(19-2)13-17-20(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16-17H,13H2,1-2H3 |
| InChIKey | BKMPVHXTXQAYJQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|