C18H18O2 — CID 101034746
1,7-dimethoxy-2-methyl-3-phenyl-1H-indene (PubChem CID 101034746) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1,7-dimethoxy-2-methyl-3-phenyl-1H-indene.
| Compound Name | 1,7-dimethoxy-2-methyl-3-phenyl-1H-indene |
|---|---|
| PubChem CID | 101034746 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1,7-dimethoxy-2-methyl-3-phenyl-1H-indene |
| SMILES | COc1cccc2c1C(OC)C(C)=C2c1ccccc1 |
| InChI | InChI=1S/C18H18O2/c1-12-16(13-8-5-4-6-9-13)14-10-7-11-15(19-2)17(14)18(12)20-3/h4-11,18H,1-3H3 |
| InChIKey | DMHVBZMIQSXKMM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |