C23H36O5 — CID 101036868
methyl (E)-5-[(1R,2S,3R,4aR,6S,8aR)-3-acetyloxy-6-hydroxy-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpent-2-enoate (PubChem CID 101036868) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is methyl (E)-5-[(1R,2S,3R,4aR,6S,8aR)-3-acetyloxy-6-hydroxy-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpent-2-enoate.
| Compound Name | methyl (E)-5-[(1R,2S,3R,4aR,6S,8aR)-3-acetyloxy-6-hydroxy-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 101036868 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | methyl (E)-5-[(1R,2S,3R,4aR,6S,8aR)-3-acetyloxy-6-hydroxy-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpent-2-enoate |
| SMILES | C=C1[C@@H](O)CC[C@@H]2[C@@](C)(CC/C(C)=C/C(=O)OC)[C@H](C)[C@H](OC(C)=O)C[C@@]12C |
| InChI | InChI=1S/C23H36O5/c1-14(12-21(26)27-7)10-11-22(5)16(3)19(28-17(4)24)13-23(6)15(2)18(25)8-9-20(22)23/h12,16,18-20,25H,2,8-11,13H2,1,3-7H3/b14-12+/t16-,18+,19-,20-,22+,23+/m1/s1 |
| InChIKey | MNVUZMNFPKHROO-ZRZSYHNPSA-N |
| XLogP | 4.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|