C21H38O2Si — CID 101049804
tert-butyl-dimethyl-[[(2R,4S,13R,14S)-3-oxatricyclo[11.2.1.02,4]hexadec-1(16)-en-14-yl]oxy]silane (PubChem CID 101049804) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2R,4S,13R,14S)-3-oxatricyclo[11.2.1.02,4]hexadec-1(16)-en-14-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2R,4S,13R,14S)-3-oxatricyclo[11.2.1.02,4]hexadec-1(16)-en-14-yl]oxy]silane |
|---|---|
| PubChem CID | 101049804 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | tert-butyl-dimethyl-[[(2R,4S,13R,14S)-3-oxatricyclo[11.2.1.02,4]hexadec-1(16)-en-14-yl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC2=C[C@H]1CCCCCCCC[C@@H]1O[C@H]21 |
| InChI | InChI=1S/C21H38O2Si/c1-21(2,3)24(4,5)23-19-15-17-14-16(19)12-10-8-6-7-9-11-13-18-20(17)22-18/h14,16,18-20H,6-13,15H2,1-5H3/t16-,18+,19+,20-/m1/s1 |
| InChIKey | IFOPJVQKXWMVCZ-BTHPGYMESA-N |
| XLogP | 6.22 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|