C22H16O2S4 — CID 101057992
[2-[10-(1,3-dithiol-2-ylidene)anthracen-9-ylidene]-5-(hydroxymethyl)-1,3-dithiol-4-yl]methanol (PubChem CID 101057992) has the molecular formula C22H16O2S4 and a molecular weight of 440.64 g/mol. Its IUPAC name is [2-[10-(1,3-dithiol-2-ylidene)anthracen-9-ylidene]-5-(hydroxymethyl)-1,3-dithiol-4-yl]methanol.
| Compound Name | [2-[10-(1,3-dithiol-2-ylidene)anthracen-9-ylidene]-5-(hydroxymethyl)-1,3-dithiol-4-yl]methanol |
|---|---|
| PubChem CID | 101057992 |
| Molecular Formula | C22H16O2S4 |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | [2-[10-(1,3-dithiol-2-ylidene)anthracen-9-ylidene]-5-(hydroxymethyl)-1,3-dithiol-4-yl]methanol |
| SMILES | OCC1=C(CO)SC(=c2c3ccccc3c(=C3SC=CS3)c3ccccc23)S1 |
| InChI | InChI=1S/C22H16O2S4/c23-11-17-18(12-24)28-22(27-17)20-15-7-3-1-5-13(15)19(21-25-9-10-26-21)14-6-2-4-8-16(14)20/h1-10,23-24H,11-12H2 |
| InChIKey | ANGNTFRFIYSLHP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|