C23H31PSi — CID 101090572
methyl-diphenyl-[(2E,4E)-4-(trimethylsilylmethyl)hexa-2,4-dienylidene]-λ5-phosphane (PubChem CID 101090572) has the molecular formula C23H31PSi and a molecular weight of 366.56 g/mol. Its IUPAC name is methyl-diphenyl-[(2E,4E)-4-(trimethylsilylmethyl)hexa-2,4-dienylidene]-λ5-phosphane.
| Compound Name | methyl-diphenyl-[(2E,4E)-4-(trimethylsilylmethyl)hexa-2,4-dienylidene]-λ5-phosphane |
|---|---|
| PubChem CID | 101090572 |
| Molecular Formula | C23H31PSi |
| Molecular Weight | 366.56 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | methyl-diphenyl-[(2E,4E)-4-(trimethylsilylmethyl)hexa-2,4-dienylidene]-λ5-phosphane |
| SMILES | C/C=C(\C=C\C=P(C)(c1ccccc1)c1ccccc1)C[Si](C)(C)C |
| InChI | InChI=1S/C23H31PSi/c1-6-21(20-25(3,4)5)14-13-19-24(2,22-15-9-7-10-16-22)23-17-11-8-12-18-23/h6-19H,20H2,1-5H3/b14-13+,21-6+ |
| InChIKey | FTNMPTFOGQRFOT-SKYIISTCSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.56 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|