C22H41NO4Si — CID 101108344
3-[(Z)-11-[tert-butyl(dimethyl)silyl]oxytridec-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 101108344) has the molecular formula C22H41NO4Si and a molecular weight of 411.66 g/mol. Its IUPAC name is 3-[(Z)-11-[tert-butyl(dimethyl)silyl]oxytridec-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(Z)-11-[tert-butyl(dimethyl)silyl]oxytridec-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101108344 |
| Molecular Formula | C22H41NO4Si |
| Molecular Weight | 411.66 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | 3-[(Z)-11-[tert-butyl(dimethyl)silyl]oxytridec-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | CCC(CCCCCCC/C=C\C(=O)N1CCOC1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H41NO4Si/c1-7-19(27-28(5,6)22(2,3)4)15-13-11-9-8-10-12-14-16-20(24)23-17-18-26-21(23)25/h14,16,19H,7-13,15,17-18H2,1-6H3/b16-14- |
| InChIKey | MWGHDHQFFKHAHR-PEZBUJJGSA-N |
| XLogP | 6.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|