C14H24N2O4 — CID 138547145
3-[(E)-9-amino-7-ethoxynon-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 138547145) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-[(E)-9-amino-7-ethoxynon-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-9-amino-7-ethoxynon-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 138547145 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 3-[(E)-9-amino-7-ethoxynon-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | CCOC(CCN)CCC/C=C/C(=O)N1CCOC1=O |
| InChI | InChI=1S/C14H24N2O4/c1-2-19-12(8-9-15)6-4-3-5-7-13(17)16-10-11-20-14(16)18/h5,7,12H,2-4,6,8-11,15H2,1H3/b7-5+ |
| InChIKey | BOBVPACGGOODPU-FNORWQNLSA-N |
| XLogP | 1.45 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|