C29H26Cl2N2O7 — CID 101112657
(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methyl (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-formamidopropanoate (PubChem CID 101112657) has the molecular formula C29H26Cl2N2O7 and a molecular weight of 585.44 g/mol. Its IUPAC name is (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methyl (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-formamidopropanoate.
| Compound Name | (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methyl (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-formamidopropanoate |
|---|---|
| PubChem CID | 101112657 |
| Molecular Formula | C29H26Cl2N2O7 |
| Molecular Weight | 585.44 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)methyl (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-formamidopropanoate |
| SMILES | O=CN[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)OCc1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C29H26Cl2N2O7/c30-9-11-33(12-10-31)19-7-5-17(6-8-19)13-22(32-16-34)29(39)40-15-18-14-23(35)24-25(26(18)36)28(38)21-4-2-1-3-20(21)27(24)37/h1-8,14,16,22,35-36H,9-13,15H2,(H,32,34)/t22-/m0/s1 |
| InChIKey | UAJUCRSQRPQOPI-QFIPXVFZSA-N |
| XLogP | 3.56 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|