C43H52O8Si — CID 101114221
[(2S,3S)-3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[(4-methoxyphenyl)methoxy]-3-triethylsilyloxypent-4-ynyl] acetate (PubChem CID 101114221) has the molecular formula C43H52O8Si and a molecular weight of 724.97 g/mol. Its IUPAC name is [(2S,3S)-3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[(4-methoxyphenyl)methoxy]-3-triethylsilyloxypent-4-ynyl] acetate.
| Compound Name | [(2S,3S)-3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[(4-methoxyphenyl)methoxy]-3-triethylsilyloxypent-4-ynyl] acetate |
|---|---|
| PubChem CID | 101114221 |
| Molecular Formula | C43H52O8Si |
| Molecular Weight | 724.97 g/mol |
| Exact Mass | 724.34 |
| IUPAC Name | [(2S,3S)-3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-[(4-methoxyphenyl)methoxy]-3-triethylsilyloxypent-4-ynyl] acetate |
| SMILES | C#C[C@@](COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)(O[Si](CC)(CC)CC)[C@H](COC(C)=O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C43H52O8Si/c1-9-42(51-52(10-2,11-3)12-4,41(31-48-33(5)44)49-30-34-18-24-38(45-6)25-19-34)32-50-43(35-16-14-13-15-17-35,36-20-26-39(46-7)27-21-36)37-22-28-40(47-8)29-23-37/h1,13-29,41H,10-12,30-32H2,2-8H3/t41-,42-/m0/s1 |
| InChIKey | QXFDRYDBTZXROM-COCZKOEFSA-N |
| XLogP | 8.56 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.97 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|