C47H64O7Si2 — CID 102074139
[(3S,4S)-3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]pent-1-yn-3-yl]oxy-triethylsilane (PubChem CID 102074139) has the molecular formula C47H64O7Si2 and a molecular weight of 797.19 g/mol. Its IUPAC name is [(3S,4S)-3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]pent-1-yn-3-yl]oxy-triethylsilane.
| Compound Name | [(3S,4S)-3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]pent-1-yn-3-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 102074139 |
| Molecular Formula | C47H64O7Si2 |
| Molecular Weight | 797.19 g/mol |
| Exact Mass | 796.42 |
| IUPAC Name | [(3S,4S)-3-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]pent-1-yn-3-yl]oxy-triethylsilane |
| SMILES | C#C[C@@](COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)(O[Si](CC)(CC)CC)[C@H](CO[Si](C)(C)C(C)(C)C)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C47H64O7Si2/c1-13-46(54-56(14-2,15-3)16-4,44(35-53-55(11,12)45(5,6)7)51-34-37-22-28-41(48-8)29-23-37)36-52-47(38-20-18-17-19-21-38,39-24-30-42(49-9)31-25-39)40-26-32-43(50-10)33-27-40/h1,17-33,44H,14-16,34-36H2,2-12H3/t44-,46-/m0/s1 |
| InChIKey | AZZYVTPGWLGEOF-OGUWKBQDSA-N |
| XLogP | 11.02 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.19 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|