C20H28O3 — CID 101125743
(3R,3aS,7S,7aR)-7-butyl-3-(phenylmethoxymethyl)-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one (PubChem CID 101125743) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (3R,3aS,7S,7aR)-7-butyl-3-(phenylmethoxymethyl)-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one.
| Compound Name | (3R,3aS,7S,7aR)-7-butyl-3-(phenylmethoxymethyl)-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 101125743 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (3R,3aS,7S,7aR)-7-butyl-3-(phenylmethoxymethyl)-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
| SMILES | CCCC[C@H]1CCC[C@H]2[C@@H]1C(=O)O[C@H]2COCc1ccccc1 |
| InChI | InChI=1S/C20H28O3/c1-2-3-10-16-11-7-12-17-18(23-20(21)19(16)17)14-22-13-15-8-5-4-6-9-15/h4-6,8-9,16-19H,2-3,7,10-14H2,1H3/t16-,17+,18-,19+/m0/s1 |
| InChIKey | HRPOIPYUDYLCRY-ZSYWTGECSA-N |
| XLogP | 4.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |