C21H34O2 — CID 101139368
(2R,3S)-5-butoxy-3-[(2-methylphenyl)methyl]-2-pentyloxolane (PubChem CID 101139368) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (2R,3S)-5-butoxy-3-[(2-methylphenyl)methyl]-2-pentyloxolane.
| Compound Name | (2R,3S)-5-butoxy-3-[(2-methylphenyl)methyl]-2-pentyloxolane |
|---|---|
| PubChem CID | 101139368 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (2R,3S)-5-butoxy-3-[(2-methylphenyl)methyl]-2-pentyloxolane |
| SMILES | CCCCC[C@H]1OC(OCCCC)C[C@@H]1Cc1ccccc1C |
| InChI | InChI=1S/C21H34O2/c1-4-6-8-13-20-19(15-18-12-10-9-11-17(18)3)16-21(23-20)22-14-7-5-2/h9-12,19-21H,4-8,13-16H2,1-3H3/t19-,20+,21?/m0/s1 |
| InChIKey | MNPPIFBLUHKZGM-MCOCGALXSA-N |
| XLogP | 5.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|