C14H16N2O11S2 — CID 101143095
2-[(1-methoxy-3-methoxycarbonyl-1,4-dioxopentan-3-yl)diazenyl]benzene-1,4-disulfonic acid (PubChem CID 101143095) has the molecular formula C14H16N2O11S2 and a molecular weight of 452.42 g/mol. Its IUPAC name is 2-[(1-methoxy-3-methoxycarbonyl-1,4-dioxopentan-3-yl)diazenyl]benzene-1,4-disulfonic acid.
| Compound Name | 2-[(1-methoxy-3-methoxycarbonyl-1,4-dioxopentan-3-yl)diazenyl]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 101143095 |
| Molecular Formula | C14H16N2O11S2 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 2-[(1-methoxy-3-methoxycarbonyl-1,4-dioxopentan-3-yl)diazenyl]benzene-1,4-disulfonic acid |
| SMILES | COC(=O)CC(/N=N/c1cc(S(=O)(=O)O)ccc1S(=O)(=O)O)(C(C)=O)C(=O)OC |
| InChI | InChI=1S/C14H16N2O11S2/c1-8(17)14(13(19)27-3,7-12(18)26-2)16-15-10-6-9(28(20,21)22)4-5-11(10)29(23,24)25/h4-6H,7H2,1-3H3,(H,20,21,22)(H,23,24,25)/b16-15+ |
| InChIKey | CNOACGPSSGFKHQ-FOCLMDBBSA-N |
| XLogP | 0.33 |
| TPSA | 203.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|