C16H19N5O8S2 — CID 143444200
2-[(6-acetamido-2-formamido-3-pyridinyl)diazenyl]benzene-1,4-disulfonic acid;ethane (PubChem CID 143444200) has the molecular formula C16H19N5O8S2 and a molecular weight of 473.49 g/mol. Its IUPAC name is 2-[(6-acetamido-2-formamido-3-pyridinyl)diazenyl]benzene-1,4-disulfonic acid;ethane.
| Compound Name | 2-[(6-acetamido-2-formamido-3-pyridinyl)diazenyl]benzene-1,4-disulfonic acid;ethane |
|---|---|
| PubChem CID | 143444200 |
| Molecular Formula | C16H19N5O8S2 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 2-[(6-acetamido-2-formamido-3-pyridinyl)diazenyl]benzene-1,4-disulfonic acid;ethane |
| SMILES | CC.CC(=O)Nc1ccc(/N=N/c2cc(S(=O)(=O)O)ccc2S(=O)(=O)O)c(NC=O)n1 |
| InChI | InChI=1S/C14H13N5O8S2.C2H6/c1-8(21)16-13-5-3-10(14(17-13)15-7-20)18-19-11-6-9(28(22,23)24)2-4-12(11)29(25,26)27;1-2/h2-7H,1H3,(H,22,23,24)(H,25,26,27)(H2,15,16,17,20,21);1-2H3/b19-18+; |
| InChIKey | RUBTWYSVALRTBN-LTRPLHCISA-N |
| XLogP | 2.54 |
| TPSA | 204.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|