C44H34F4O6 — CID 101148932
[3-[4-[2-(4-butoxy-2,3-difluorophenyl)ethynyl]benzoyl]oxyphenyl] 4-[2-(4-butoxy-2,3-difluorophenyl)ethynyl]benzoate (PubChem CID 101148932) has the molecular formula C44H34F4O6 and a molecular weight of 734.74 g/mol. Its IUPAC name is [3-[4-[2-(4-butoxy-2,3-difluorophenyl)ethynyl]benzoyl]oxyphenyl] 4-[2-(4-butoxy-2,3-difluorophenyl)ethynyl]benzoate.
| Compound Name | [3-[4-[2-(4-butoxy-2,3-difluorophenyl)ethynyl]benzoyl]oxyphenyl] 4-[2-(4-butoxy-2,3-difluorophenyl)ethynyl]benzoate |
|---|---|
| PubChem CID | 101148932 |
| Molecular Formula | C44H34F4O6 |
| Molecular Weight | 734.74 g/mol |
| Exact Mass | 734.23 |
| IUPAC Name | [3-[4-[2-(4-butoxy-2,3-difluorophenyl)ethynyl]benzoyl]oxyphenyl] 4-[2-(4-butoxy-2,3-difluorophenyl)ethynyl]benzoate |
| SMILES | CCCCOc1ccc(C#Cc2ccc(C(=O)Oc3cccc(OC(=O)c4ccc(C#Cc5ccc(OCCCC)c(F)c5F)cc4)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C44H34F4O6/c1-3-5-26-51-37-24-22-31(39(45)41(37)47)16-10-29-12-18-33(19-13-29)43(49)53-35-8-7-9-36(28-35)54-44(50)34-20-14-30(15-21-34)11-17-32-23-25-38(42(48)40(32)46)52-27-6-4-2/h7-9,12-15,18-25,28H,3-6,26-27H2,1-2H3 |
| InChIKey | BIAMOUXDUILTOG-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.74 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|