C6H19NSi2 — CID 101161157
N,N-bis(dimethylsilyl)ethanamine (PubChem CID 101161157) has the molecular formula C6H19NSi2 and a molecular weight of 161.40 g/mol. Its IUPAC name is N,N-bis(dimethylsilyl)ethanamine.
| Compound Name | N,N-bis(dimethylsilyl)ethanamine |
|---|---|
| PubChem CID | 101161157 |
| Molecular Formula | C6H19NSi2 |
| Molecular Weight | 161.40 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | N,N-bis(dimethylsilyl)ethanamine |
| SMILES | CCN([SiH](C)C)[SiH](C)C |
| InChI | InChI=1S/C6H19NSi2/c1-6-7(8(2)3)9(4)5/h8-9H,6H2,1-5H3 |
| InChIKey | HXRPNKYNRBAYOP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|