C41H35N2O4+ — CID 101171493
2-N,2-N,7-N,7-N-tetrakis(4-methoxyphenyl)-9H-fluoren-9-ylium-2,7-diamine (PubChem CID 101171493) has the molecular formula C41H35N2O4+ and a molecular weight of 619.74 g/mol. Its IUPAC name is 2-N,2-N,7-N,7-N-tetrakis(4-methoxyphenyl)-9H-fluoren-9-ylium-2,7-diamine.
| Compound Name | 2-N,2-N,7-N,7-N-tetrakis(4-methoxyphenyl)-9H-fluoren-9-ylium-2,7-diamine |
|---|---|
| PubChem CID | 101171493 |
| Molecular Formula | C41H35N2O4+ |
| Molecular Weight | 619.74 g/mol |
| Exact Mass | 619.26 |
| IUPAC Name | 2-N,2-N,7-N,7-N-tetrakis(4-methoxyphenyl)-9H-fluoren-9-ylium-2,7-diamine |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc3c(c2)[CH+]c2cc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C41H35N2O4/c1-44-36-15-5-30(6-16-36)42(31-7-17-37(45-2)18-8-31)34-13-23-40-28(26-34)25-29-27-35(14-24-41(29)40)43(32-9-19-38(46-3)20-10-32)33-11-21-39(47-4)22-12-33/h5-27H,1-4H3/q+1 |
| InChIKey | YRFXJYMLCLHUPO-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.74 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|