C20H19F3O3S2 — CID 101172552
(6-benzyl-2-phenylsulfanylcyclohexen-1-yl) trifluoromethanesulfonate (PubChem CID 101172552) has the molecular formula C20H19F3O3S2 and a molecular weight of 428.50 g/mol. Its IUPAC name is (6-benzyl-2-phenylsulfanylcyclohexen-1-yl) trifluoromethanesulfonate.
| Compound Name | (6-benzyl-2-phenylsulfanylcyclohexen-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101172552 |
| Molecular Formula | C20H19F3O3S2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | (6-benzyl-2-phenylsulfanylcyclohexen-1-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1=C(Sc2ccccc2)CCCC1Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H19F3O3S2/c21-20(22,23)28(24,25)26-19-16(14-15-8-3-1-4-9-15)10-7-13-18(19)27-17-11-5-2-6-12-17/h1-6,8-9,11-12,16H,7,10,13-14H2 |
| InChIKey | CRECNQFRWKPDBE-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|