C11H8ClF3OSe — CID 101207021
(Z)-4-(4-chlorophenyl)-1,1,1-trifluoro-4-methylselanylbut-3-en-2-one (PubChem CID 101207021) has the molecular formula C11H8ClF3OSe and a molecular weight of 327.59 g/mol. Its IUPAC name is (Z)-4-(4-chlorophenyl)-1,1,1-trifluoro-4-methylselanylbut-3-en-2-one.
| Compound Name | (Z)-4-(4-chlorophenyl)-1,1,1-trifluoro-4-methylselanylbut-3-en-2-one |
|---|---|
| PubChem CID | 101207021 |
| Molecular Formula | C11H8ClF3OSe |
| Molecular Weight | 327.59 g/mol |
| Exact Mass | 327.94 |
| IUPAC Name | (Z)-4-(4-chlorophenyl)-1,1,1-trifluoro-4-methylselanylbut-3-en-2-one |
| SMILES | C[Se]/C(=C\C(=O)C(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H8ClF3OSe/c1-17-9(6-10(16)11(13,14)15)7-2-4-8(12)5-3-7/h2-6H,1H3/b9-6- |
| InChIKey | CGXYXRWRWHJUTL-TWGQIWQCSA-N |
| XLogP | 3.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|