C30H32OSi — CID 101226954
(1E)-4,4-dimethyl-1,7,7-triphenyl-5-trimethylsilylhepta-1,5,6-trien-3-one (PubChem CID 101226954) has the molecular formula C30H32OSi and a molecular weight of 436.67 g/mol. Its IUPAC name is (1E)-4,4-dimethyl-1,7,7-triphenyl-5-trimethylsilylhepta-1,5,6-trien-3-one.
| Compound Name | (1E)-4,4-dimethyl-1,7,7-triphenyl-5-trimethylsilylhepta-1,5,6-trien-3-one |
|---|---|
| PubChem CID | 101226954 |
| Molecular Formula | C30H32OSi |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (1E)-4,4-dimethyl-1,7,7-triphenyl-5-trimethylsilylhepta-1,5,6-trien-3-one |
| SMILES | CC(C)(C(=O)/C=C/c1ccccc1)C(=C=C(c1ccccc1)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C30H32OSi/c1-30(2,28(31)22-21-24-15-9-6-10-16-24)29(32(3,4)5)23-27(25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-22H,1-5H3/b22-21+ |
| InChIKey | KSCLCDZIHCLNKH-QURGRASLSA-N |
| XLogP | 7.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|