C30H36O8Si — CID 101232750
[(4aR,6R,7R,8S,8aR)-7-acetyloxy-2-anthracen-9-yl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 101232750) has the molecular formula C30H36O8Si and a molecular weight of 552.70 g/mol. Its IUPAC name is [(4aR,6R,7R,8S,8aR)-7-acetyloxy-2-anthracen-9-yl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(4aR,6R,7R,8S,8aR)-7-acetyloxy-2-anthracen-9-yl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 101232750 |
| Molecular Formula | C30H36O8Si |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | [(4aR,6R,7R,8S,8aR)-7-acetyloxy-2-anthracen-9-yl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OCC[Si](C)(C)C)O[C@@H]2COC(c3c4ccccc4cc4ccccc34)O[C@@H]12 |
| InChI | InChI=1S/C30H36O8Si/c1-18(31)35-27-26-24(37-30(28(27)36-19(2)32)33-14-15-39(3,4)5)17-34-29(38-26)25-22-12-8-6-10-20(22)16-21-11-7-9-13-23(21)25/h6-13,16,24,26-30H,14-15,17H2,1-5H3/t24-,26-,27+,28-,29?,30-/m1/s1 |
| InChIKey | BJZLYFCUYWVQEH-SDXZELHFSA-N |
| XLogP | 5.35 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|