C29H31N3O3Si — CID 101234187
[(2R,5R)-5-(2-aminoquinazolin-5-yl)-3-[tert-butyl(diphenyl)silyl]oxy-2,5-dihydrofuran-2-yl]methanol (PubChem CID 101234187) has the molecular formula C29H31N3O3Si and a molecular weight of 497.67 g/mol. Its IUPAC name is [(2R,5R)-5-(2-aminoquinazolin-5-yl)-3-[tert-butyl(diphenyl)silyl]oxy-2,5-dihydrofuran-2-yl]methanol.
| Compound Name | [(2R,5R)-5-(2-aminoquinazolin-5-yl)-3-[tert-butyl(diphenyl)silyl]oxy-2,5-dihydrofuran-2-yl]methanol |
|---|---|
| PubChem CID | 101234187 |
| Molecular Formula | C29H31N3O3Si |
| Molecular Weight | 497.67 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | [(2R,5R)-5-(2-aminoquinazolin-5-yl)-3-[tert-butyl(diphenyl)silyl]oxy-2,5-dihydrofuran-2-yl]methanol |
| SMILES | CC(C)(C)[Si](OC1=C[C@H](c2cccc3nc(N)ncc23)O[C@@H]1CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H31N3O3Si/c1-29(2,3)36(20-11-6-4-7-12-20,21-13-8-5-9-14-21)35-26-17-25(34-27(26)19-33)22-15-10-16-24-23(22)18-31-28(30)32-24/h4-18,25,27,33H,19H2,1-3H3,(H2,30,31,32)/t25-,27-/m1/s1 |
| InChIKey | HCNALUGOSSHWRF-XNMGPUDCSA-N |
| XLogP | 4.10 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.67 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|