C20H39N — CID 101243485
(E)-1-cyclohexyl-3-ethyl-N,2-dipropylhex-2-en-1-amine (PubChem CID 101243485) has the molecular formula C20H39N and a molecular weight of 293.54 g/mol. Its IUPAC name is (E)-1-cyclohexyl-3-ethyl-N,2-dipropylhex-2-en-1-amine.
| Compound Name | (E)-1-cyclohexyl-3-ethyl-N,2-dipropylhex-2-en-1-amine |
|---|---|
| PubChem CID | 101243485 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | (E)-1-cyclohexyl-3-ethyl-N,2-dipropylhex-2-en-1-amine |
| SMILES | CCCNC(/C(CCC)=C(\CC)CCC)C1CCCCC1 |
| InChI | InChI=1S/C20H39N/c1-5-12-17(8-4)19(13-6-2)20(21-16-7-3)18-14-10-9-11-15-18/h18,20-21H,5-16H2,1-4H3/b19-17+ |
| InChIKey | NKWBQRBQKFPUPL-HTXNQAPBSA-N |
| XLogP | 6.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|