C18H22N+ — CID 101246717
N-(cyclohexatrienylmethyl)-N-(cyclohexa-1,2,5-trien-1-ylmethyl)-2-methylpropan-2-amine (PubChem CID 101246717) has the molecular formula C18H22N+ and a molecular weight of 252.38 g/mol. Its IUPAC name is N-(cyclohexatrienylmethyl)-N-(cyclohexa-1,2,5-trien-1-ylmethyl)-2-methylpropan-2-amine.
| Compound Name | N-(cyclohexatrienylmethyl)-N-(cyclohexa-1,2,5-trien-1-ylmethyl)-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 101246717 |
| Molecular Formula | C18H22N+ |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | N-(cyclohexatrienylmethyl)-N-(cyclohexa-1,2,5-trien-1-ylmethyl)-2-methylpropan-2-amine |
| SMILES | CC(C)(C)N(CC1=C=CCC=C1)CC1=CC=CC=[C+]1 |
| InChI | InChI=1S/C18H22N/c1-18(2,3)19(14-16-10-6-4-7-11-16)15-17-12-8-5-9-13-17/h4,6-10,12H,5,14-15H2,1-3H3/q+1 |
| InChIKey | FAZKFIAHETWNNM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|