C19H25NO5S — CID 101246857
methyl 2-[1-(4-methylphenyl)sulfonyl-2-oxo-1-azaspiro[4.5]decan-3-yl]acetate (PubChem CID 101246857) has the molecular formula C19H25NO5S and a molecular weight of 379.48 g/mol. Its IUPAC name is methyl 2-[1-(4-methylphenyl)sulfonyl-2-oxo-1-azaspiro[4.5]decan-3-yl]acetate.
| Compound Name | methyl 2-[1-(4-methylphenyl)sulfonyl-2-oxo-1-azaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 101246857 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | methyl 2-[1-(4-methylphenyl)sulfonyl-2-oxo-1-azaspiro[4.5]decan-3-yl]acetate |
| SMILES | COC(=O)CC1CC2(CCCCC2)N(S(=O)(=O)c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C19H25NO5S/c1-14-6-8-16(9-7-14)26(23,24)20-18(22)15(12-17(21)25-2)13-19(20)10-4-3-5-11-19/h6-9,15H,3-5,10-13H2,1-2H3 |
| InChIKey | JXOYLXLXRJYTJA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |