C15H24O2 — CID 101253131
(4E,8E)-4,7,7-trimethyl-10-oxododeca-4,8-dienal (PubChem CID 101253131) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (4E,8E)-4,7,7-trimethyl-10-oxododeca-4,8-dienal.
| Compound Name | (4E,8E)-4,7,7-trimethyl-10-oxododeca-4,8-dienal |
|---|---|
| PubChem CID | 101253131 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (4E,8E)-4,7,7-trimethyl-10-oxododeca-4,8-dienal |
| SMILES | CCC(=O)/C=C/C(C)(C)C/C=C(\C)CCC=O |
| InChI | InChI=1S/C15H24O2/c1-5-14(17)9-11-15(3,4)10-8-13(2)7-6-12-16/h8-9,11-12H,5-7,10H2,1-4H3/b11-9+,13-8+ |
| InChIKey | WWVHKPBSUOUGBV-RRURSIDFSA-N |
| XLogP | 3.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|