C17H27BrO2 — CID 139909044
ethyl 11-bromo-4,4,7-trimethyldodeca-2,6,10-trienoate (PubChem CID 139909044) has the molecular formula C17H27BrO2 and a molecular weight of 343.31 g/mol. Its IUPAC name is ethyl 11-bromo-4,4,7-trimethyldodeca-2,6,10-trienoate.
| Compound Name | ethyl 11-bromo-4,4,7-trimethyldodeca-2,6,10-trienoate |
|---|---|
| PubChem CID | 139909044 |
| Molecular Formula | C17H27BrO2 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | ethyl 11-bromo-4,4,7-trimethyldodeca-2,6,10-trienoate |
| SMILES | CCOC(=O)C=CC(C)(C)CC=C(C)CCC=C(C)Br |
| InChI | InChI=1S/C17H27BrO2/c1-6-20-16(19)11-13-17(4,5)12-10-14(2)8-7-9-15(3)18/h9-11,13H,6-8,12H2,1-5H3 |
| InChIKey | RADUDNYPOZFRAG-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|