C27H52O3Si — CID 101253747
tert-butyl-[(2S,5E,9E)-5,9-dimethyl-12-(2-methyl-1,3-dioxolan-2-yl)-2-propan-2-yldodeca-5,9-dienoxy]-dimethylsilane (PubChem CID 101253747) has the molecular formula C27H52O3Si and a molecular weight of 452.80 g/mol. Its IUPAC name is tert-butyl-[(2S,5E,9E)-5,9-dimethyl-12-(2-methyl-1,3-dioxolan-2-yl)-2-propan-2-yldodeca-5,9-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2S,5E,9E)-5,9-dimethyl-12-(2-methyl-1,3-dioxolan-2-yl)-2-propan-2-yldodeca-5,9-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101253747 |
| Molecular Formula | C27H52O3Si |
| Molecular Weight | 452.80 g/mol |
| Exact Mass | 452.37 |
| IUPAC Name | tert-butyl-[(2S,5E,9E)-5,9-dimethyl-12-(2-methyl-1,3-dioxolan-2-yl)-2-propan-2-yldodeca-5,9-dienoxy]-dimethylsilane |
| SMILES | C/C(=C\CCC1(C)OCCO1)CC/C=C(\C)CC[C@H](CO[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C27H52O3Si/c1-22(2)25(21-30-31(9,10)26(5,6)7)17-16-24(4)14-11-13-23(3)15-12-18-27(8)28-19-20-29-27/h14-15,22,25H,11-13,16-21H2,1-10H3/b23-15+,24-14+/t25-/m1/s1 |
| InChIKey | AVEINBVJHDAURB-UKEWDJNMSA-N |
| XLogP | 8.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.80 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|