C12H24O4Si2 — CID 101261490
5-trimethylsilyloxy-2-(trimethylsilyloxymethyl)-2,3-dihydropyran-4-one (PubChem CID 101261490) has the molecular formula C12H24O4Si2 and a molecular weight of 288.49 g/mol. Its IUPAC name is 5-trimethylsilyloxy-2-(trimethylsilyloxymethyl)-2,3-dihydropyran-4-one.
| Compound Name | 5-trimethylsilyloxy-2-(trimethylsilyloxymethyl)-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 101261490 |
| Molecular Formula | C12H24O4Si2 |
| Molecular Weight | 288.49 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 5-trimethylsilyloxy-2-(trimethylsilyloxymethyl)-2,3-dihydropyran-4-one |
| SMILES | C[Si](C)(C)OCC1CC(=O)C(O[Si](C)(C)C)=CO1 |
| InChI | InChI=1S/C12H24O4Si2/c1-17(2,3)15-8-10-7-11(13)12(9-14-10)16-18(4,5)6/h9-10H,7-8H2,1-6H3 |
| InChIKey | XRDXPKPOJKPDAP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|