C15H3Na5O10 — CID 101297517
pentasodium;naphthalene-1,2,3,4,6-pentacarboxylate (PubChem CID 101297517) has the molecular formula C15H3Na5O10 and a molecular weight of 458.13 g/mol. Its IUPAC name is pentasodium;naphthalene-1,2,3,4,6-pentacarboxylate.
| Compound Name | pentasodium;naphthalene-1,2,3,4,6-pentacarboxylate |
|---|---|
| PubChem CID | 101297517 |
| Molecular Formula | C15H3Na5O10 |
| Molecular Weight | 458.13 g/mol |
| Exact Mass | 457.92 |
| IUPAC Name | pentasodium;naphthalene-1,2,3,4,6-pentacarboxylate |
| SMILES | O=C([O-])c1ccc2c(C(=O)[O-])c(C(=O)[O-])c(C(=O)[O-])c(C(=O)[O-])c2c1.[Na+].[Na+].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C15H8O10.5Na/c16-11(17)4-1-2-5-6(3-4)8(13(20)21)10(15(24)25)9(14(22)23)7(5)12(18)19;;;;;/h1-3H,(H,16,17)(H,18,19)(H,20,21)(H,22,23)(H,24,25);;;;;/q;5*+1/p-5 |
| InChIKey | HVPJVKYXLYZSAI-UHFFFAOYSA-I |
| XLogP | -20.32 |
| TPSA | 200.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.13 |
| LogP ≤ 5 | -20.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |