C26H24N2O3 — CID 101339226
(3R,4S,5S)-4-(4-methoxyanilino)-5-(2-phenylethynyl)-3-phenylmethoxypyrrolidin-2-one (PubChem CID 101339226) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is (3R,4S,5S)-4-(4-methoxyanilino)-5-(2-phenylethynyl)-3-phenylmethoxypyrrolidin-2-one.
| Compound Name | (3R,4S,5S)-4-(4-methoxyanilino)-5-(2-phenylethynyl)-3-phenylmethoxypyrrolidin-2-one |
|---|---|
| PubChem CID | 101339226 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | (3R,4S,5S)-4-(4-methoxyanilino)-5-(2-phenylethynyl)-3-phenylmethoxypyrrolidin-2-one |
| SMILES | COc1ccc(N[C@H]2[C@H](C#Cc3ccccc3)NC(=O)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H24N2O3/c1-30-22-15-13-21(14-16-22)27-24-23(17-12-19-8-4-2-5-9-19)28-26(29)25(24)31-18-20-10-6-3-7-11-20/h2-11,13-16,23-25,27H,18H2,1H3,(H,28,29)/t23-,24-,25+/m0/s1 |
| InChIKey | OMASMGDVKUIBHM-CCDWMCETSA-N |
| XLogP | 3.61 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|