C15H28N3O2 — CID 101344478
CID 101344478 (PubChem CID 101344478) has the molecular formula C15H28N3O2 and a molecular weight of 282.41 g/mol.
| Compound Name | CID 101344478 |
|---|---|
| PubChem CID | 101344478 |
| Molecular Formula | C15H28N3O2 |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NC(=O)N2CCCCC2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C15H28N3O2/c1-14(2)10-12(11-15(3,4)18(14)20)16-13(19)17-8-6-5-7-9-17/h12H,5-11H2,1-4H3,(H,16,19) |
| InChIKey | BTPKWAQLBYRYQN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |