C17H23NO4 — CID 101348910
2-(1-hydroxycyclohexyl)-2-(3,4,5-trimethoxyphenyl)acetonitrile (PubChem CID 101348910) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-(1-hydroxycyclohexyl)-2-(3,4,5-trimethoxyphenyl)acetonitrile.
| Compound Name | 2-(1-hydroxycyclohexyl)-2-(3,4,5-trimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 101348910 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-(1-hydroxycyclohexyl)-2-(3,4,5-trimethoxyphenyl)acetonitrile |
| SMILES | COc1cc(C(C#N)C2(O)CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C17H23NO4/c1-20-14-9-12(10-15(21-2)16(14)22-3)13(11-18)17(19)7-5-4-6-8-17/h9-10,13,19H,4-8H2,1-3H3 |
| InChIKey | GSMYVIHSMRSZSZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |