About tert-butyl-(3,5-dimethylphenyl)azanide
tert-butyl-(3,5-dimethylphenyl)azanide (PubChem CID 101349910) has the molecular formula C12H18N-
and a molecular weight of 176.28 g/mol. Its IUPAC name is tert-butyl-(3,5-dimethylphenyl)azanide.
Molecular Properties
| Compound Name | tert-butyl-(3,5-dimethylphenyl)azanide |
| PubChem CID | 101349910 |
| Molecular Formula | C12H18N- |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | tert-butyl-(3,5-dimethylphenyl)azanide |
| SMILES | Cc1cc(C)cc([N-]C(C)(C)C)c1 |
| InChI | InChI=1S/C12H18N/c1-9-6-10(2)8-11(7-9)13-12(3,4)5/h6-8H,1-5H3/q-1 |
| InChIKey | RZWOXIINIVXDMP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tert-butyl-(3,5-dimethylphenyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(3,5-dimethylphenyl)azanide?
The IUPAC name of tert-butyl-(3,5-dimethylphenyl)azanide (CID 101349910) is tert-butyl-(3,5-dimethylphenyl)azanide.
What is the SMILES notation for tert-butyl-(3,5-dimethylphenyl)azanide?
The canonical SMILES for tert-butyl-(3,5-dimethylphenyl)azanide is Cc1cc(C)cc([N-]C(C)(C)C)c1.
What is the InChIKey of tert-butyl-(3,5-dimethylphenyl)azanide?
The InChIKey is RZWOXIINIVXDMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N/c1-9-6-10(2)8-11(7-9)13-12(3,4)5/h6-8H,1-5H3/q-1.
What are the key properties of tert-butyl-(3,5-dimethylphenyl)azanide?
tert-butyl-(3,5-dimethylphenyl)azanide has a molecular weight of 176.28 g/mol, XLogP of 4.11, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(3,5-dimethylphenyl)azanide is sourced from PubChem (CID 101349910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).