C20H36O6Si — CID 101358007
3-O-tert-butyl 1-O-methyl 2-[(E)-4-acetyloxy-2-triethylsilylbut-2-enyl]propanedioate (PubChem CID 101358007) has the molecular formula C20H36O6Si and a molecular weight of 400.59 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl 2-[(E)-4-acetyloxy-2-triethylsilylbut-2-enyl]propanedioate.
| Compound Name | 3-O-tert-butyl 1-O-methyl 2-[(E)-4-acetyloxy-2-triethylsilylbut-2-enyl]propanedioate |
|---|---|
| PubChem CID | 101358007 |
| Molecular Formula | C20H36O6Si |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl 2-[(E)-4-acetyloxy-2-triethylsilylbut-2-enyl]propanedioate |
| SMILES | CC[Si](CC)(CC)/C(=C/COC(C)=O)CC(C(=O)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H36O6Si/c1-9-27(10-2,11-3)16(12-13-25-15(4)21)14-17(18(22)24-8)19(23)26-20(5,6)7/h12,17H,9-11,13-14H2,1-8H3/b16-12+ |
| InChIKey | CKEYBFDOBVXWOA-FOWTUZBSSA-N |
| XLogP | 4.04 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|