C18H32O6Si — CID 101358012
3-O-tert-butyl 1-O-methyl 2-[[(2R,3R)-3-formyl-2-triethylsilyloxiran-2-yl]methyl]propanedioate (PubChem CID 101358012) has the molecular formula C18H32O6Si and a molecular weight of 372.53 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl 2-[[(2R,3R)-3-formyl-2-triethylsilyloxiran-2-yl]methyl]propanedioate.
| Compound Name | 3-O-tert-butyl 1-O-methyl 2-[[(2R,3R)-3-formyl-2-triethylsilyloxiran-2-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 101358012 |
| Molecular Formula | C18H32O6Si |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl 2-[[(2R,3R)-3-formyl-2-triethylsilyloxiran-2-yl]methyl]propanedioate |
| SMILES | CC[Si](CC)(CC)[C@@]1(CC(C(=O)OC)C(=O)OC(C)(C)C)O[C@@H]1C=O |
| InChI | InChI=1S/C18H32O6Si/c1-8-25(9-2,10-3)18(14(12-19)23-18)11-13(15(20)22-7)16(21)24-17(4,5)6/h12-14H,8-11H2,1-7H3/t13?,14-,18-/m1/s1 |
| InChIKey | OYOILRVWCWXGIW-JDPNFYKBSA-N |
| XLogP | 2.89 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|