C45H54N2O7 — CID 101367203
tert-butyl (2S)-2-[[2-[(2S,3S,4R,5R,6S)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)-1-prop-2-enylpiperidin-2-yl]acetyl]amino]-3-phenylpropanoate (PubChem CID 101367203) has the molecular formula C45H54N2O7 and a molecular weight of 734.93 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-[(2S,3S,4R,5R,6S)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)-1-prop-2-enylpiperidin-2-yl]acetyl]amino]-3-phenylpropanoate.
| Compound Name | tert-butyl (2S)-2-[[2-[(2S,3S,4R,5R,6S)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)-1-prop-2-enylpiperidin-2-yl]acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 101367203 |
| Molecular Formula | C45H54N2O7 |
| Molecular Weight | 734.93 g/mol |
| Exact Mass | 734.39 |
| IUPAC Name | tert-butyl (2S)-2-[[2-[(2S,3S,4R,5R,6S)-6-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)-1-prop-2-enylpiperidin-2-yl]acetyl]amino]-3-phenylpropanoate |
| SMILES | C=CCN1[C@@H](CC(=O)N[C@@H](Cc2ccccc2)C(=O)OC(C)(C)C)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1CO |
| InChI | InChI=1S/C45H54N2O7/c1-5-26-47-38(28-40(49)46-37(44(50)54-45(2,3)4)27-33-18-10-6-11-19-33)41(51-30-34-20-12-7-13-21-34)43(53-32-36-24-16-9-17-25-36)42(39(47)29-48)52-31-35-22-14-8-15-23-35/h5-25,37-39,41-43,48H,1,26-32H2,2-4H3,(H,46,49)/t37-,38-,39-,41-,42+,43+/m0/s1 |
| InChIKey | WKWRBYUNDMDOSP-HKIIEYDPSA-N |
| XLogP | 6.43 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.93 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|