C18H12N8O11 — CID 101372573
(1S,2S,10R,11R)-8,10-dinitro-4-oxido-5-(2,4,6-trinitrophenyl)-5,6-diaza-4-azoniatetracyclo[9.2.2.02,10.03,7]pentadeca-3,6,8,12-tetraene (PubChem CID 101372573) has the molecular formula C18H12N8O11 and a molecular weight of 516.34 g/mol. Its IUPAC name is (1S,2S,10R,11R)-8,10-dinitro-4-oxido-5-(2,4,6-trinitrophenyl)-5,6-diaza-4-azoniatetracyclo[9.2.2.02,10.03,7]pentadeca-3,6,8,12-tetraene.
| Compound Name | (1S,2S,10R,11R)-8,10-dinitro-4-oxido-5-(2,4,6-trinitrophenyl)-5,6-diaza-4-azoniatetracyclo[9.2.2.02,10.03,7]pentadeca-3,6,8,12-tetraene |
|---|---|
| PubChem CID | 101372573 |
| Molecular Formula | C18H12N8O11 |
| Molecular Weight | 516.34 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | (1S,2S,10R,11R)-8,10-dinitro-4-oxido-5-(2,4,6-trinitrophenyl)-5,6-diaza-4-azoniatetracyclo[9.2.2.02,10.03,7]pentadeca-3,6,8,12-tetraene |
| SMILES | O=[N+]([O-])C1=C[C@]2([N+](=O)[O-])[C@H]3C=C[C@H](CC3)[C@@H]2c2c1nn(-c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-])[n+]2[O-] |
| InChI | InChI=1S/C18H12N8O11/c27-21-17-14-8-1-3-9(4-2-8)18(14,26(36)37)7-13(25(34)35)15(17)19-20(21)16-11(23(30)31)5-10(22(28)29)6-12(16)24(32)33/h1,3,5-9,14H,2,4H2/t8-,9+,14-,18+/m1/s1 |
| InChIKey | PQAIDLAOKVETIP-PILBTRMYSA-N |
| XLogP | 1.56 |
| TPSA | 260.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|