C15H12N4O7 — CID 11314384
(1S,12R)-9-methyl-5,7,11-trinitro-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6,13-tetraen-10-one (PubChem CID 11314384) has the molecular formula C15H12N4O7 and a molecular weight of 360.28 g/mol. Its IUPAC name is (1S,12R)-9-methyl-5,7,11-trinitro-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6,13-tetraen-10-one.
| Compound Name | (1S,12R)-9-methyl-5,7,11-trinitro-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6,13-tetraen-10-one |
|---|---|
| PubChem CID | 11314384 |
| Molecular Formula | C15H12N4O7 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | (1S,12R)-9-methyl-5,7,11-trinitro-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6,13-tetraen-10-one |
| SMILES | CN1C(=O)C2([N+](=O)[O-])C(c3cc([N+](=O)[O-])cc([N+](=O)[O-])c31)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C15H12N4O7/c1-16-13-10(5-9(17(21)22)6-11(13)18(23)24)12-7-2-3-8(4-7)15(12,14(16)20)19(25)26/h2-3,5-8,12H,4H2,1H3/t7-,8+,12?,15?/m1/s1 |
| InChIKey | JDCPSBPHISJNMQ-VQLVPUDHSA-N |
| XLogP | 1.78 |
| TPSA | 149.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|