C18H22N5O8+ — CID 135431637
1-methyl-4-(2-methyl-1-morpholin-4-ium-4-ylidenepropan-2-yl)-3,6,8-trinitro-4H-quinolin-2-ol (PubChem CID 135431637) has the molecular formula C18H22N5O8+ and a molecular weight of 436.40 g/mol. Its IUPAC name is 1-methyl-4-(2-methyl-1-morpholin-4-ium-4-ylidenepropan-2-yl)-3,6,8-trinitro-4H-quinolin-2-ol.
| Compound Name | 1-methyl-4-(2-methyl-1-morpholin-4-ium-4-ylidenepropan-2-yl)-3,6,8-trinitro-4H-quinolin-2-ol |
|---|---|
| PubChem CID | 135431637 |
| Molecular Formula | C18H22N5O8+ |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 1-methyl-4-(2-methyl-1-morpholin-4-ium-4-ylidenepropan-2-yl)-3,6,8-trinitro-4H-quinolin-2-ol |
| SMILES | CN1C(O)=C([N+](=O)[O-])C(C(C)(C)C=[N+]2CCOCC2)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C18H21N5O8/c1-18(2,10-20-4-6-31-7-5-20)14-12-8-11(21(25)26)9-13(22(27)28)15(12)19(3)17(24)16(14)23(29)30/h8-10,14H,4-7H2,1-3H3/p+1 |
| InChIKey | XGVXPCXOKCIOTE-UHFFFAOYSA-O |
| XLogP | 2.18 |
| TPSA | 165.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|