C20H30N4O10 — CID 14434537
ethyl 2,2,4-trimethyl-3-morpholin-4-ylpentanoate;2,4,6-trinitrophenol (PubChem CID 14434537) has the molecular formula C20H30N4O10 and a molecular weight of 486.48 g/mol. Its IUPAC name is ethyl 2,2,4-trimethyl-3-morpholin-4-ylpentanoate;2,4,6-trinitrophenol.
| Compound Name | ethyl 2,2,4-trimethyl-3-morpholin-4-ylpentanoate;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 14434537 |
| Molecular Formula | C20H30N4O10 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | ethyl 2,2,4-trimethyl-3-morpholin-4-ylpentanoate;2,4,6-trinitrophenol |
| SMILES | CCOC(=O)C(C)(C)C(C(C)C)N1CCOCC1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H27NO3.C6H3N3O7/c1-6-18-13(16)14(4,5)12(11(2)3)15-7-9-17-10-8-15;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h11-12H,6-10H2,1-5H3;1-2,10H |
| InChIKey | YRZJJGSTFVESCI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 188.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|