C9H6N4O6 — CID 57127325
1-methyl-5,7-dinitro-3-nitroso-3H-indol-2-one (PubChem CID 57127325) has the molecular formula C9H6N4O6 and a molecular weight of 266.17 g/mol. Its IUPAC name is 1-methyl-5,7-dinitro-3-nitroso-3H-indol-2-one.
| Compound Name | 1-methyl-5,7-dinitro-3-nitroso-3H-indol-2-one |
|---|---|
| PubChem CID | 57127325 |
| Molecular Formula | C9H6N4O6 |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 1-methyl-5,7-dinitro-3-nitroso-3H-indol-2-one |
| SMILES | CN1C(=O)C(N=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C9H6N4O6/c1-11-8-5(7(10-15)9(11)14)2-4(12(16)17)3-6(8)13(18)19/h2-3,7H,1H3 |
| InChIKey | PNBXQAHYAPENDN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 136.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|